C15H12ClFNO4S- — CID 2112375
[6-(3-chloro-4-fluorophenyl)sulfonyliminocyclohexa-2,4-dien-1-ylidene]-ethoxymethanolate (PubChem CID 2112375) has the molecular formula C15H12ClFNO4S- and a molecular weight of 356.78 g/mol. Its IUPAC name is [6-(3-chloro-4-fluorophenyl)sulfonyliminocyclohexa-2,4-dien-1-ylidene]-ethoxymethanolate.
| Compound Name | [6-(3-chloro-4-fluorophenyl)sulfonyliminocyclohexa-2,4-dien-1-ylidene]-ethoxymethanolate |
|---|---|
| PubChem CID | 2112375 |
| Molecular Formula | C15H12ClFNO4S- |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | [6-(3-chloro-4-fluorophenyl)sulfonyliminocyclohexa-2,4-dien-1-ylidene]-ethoxymethanolate |
| SMILES | CCOC([O-])=C1C=CC=CC1=NS(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClFNO4S/c1-2-22-15(19)11-5-3-4-6-14(11)18-23(20,21)10-7-8-13(17)12(16)9-10/h3-9,19H,2H2,1H3/p-1 |
| InChIKey | UACPTZNSZWMGNG-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|