C14H14N2O4 — CID 54688387
(Z)-[(6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]-prop-2-enoxymethanolate (PubChem CID 54688387) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is (Z)-[(6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]-prop-2-enoxymethanolate.
| Compound Name | (Z)-[(6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]-prop-2-enoxymethanolate |
|---|---|
| PubChem CID | 54688387 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (Z)-[(6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-2,4-dien-1-ylidene]-prop-2-enoxymethanolate |
| SMILES | C=CCO/C([O-])=C1/C=CC=C/C1=N\N=[C+]\C(=O)OCC |
| InChI | InChI=1S/C14H14N2O4/c1-3-9-20-14(18)11-7-5-6-8-12(11)16-15-10-13(17)19-4-2/h3,5-8H,1,4,9H2,2H3 |
| InChIKey | ITLAWLDFRZZCPZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|