About copper(1+);1-ethoxyethenolate
copper(1+);1-ethoxyethenolate (PubChem CID 73187688) has the molecular formula C4H7CuO2
and a molecular weight of 150.64 g/mol. Its IUPAC name is copper(1+);1-ethoxyethenolate.
Molecular Properties
| Compound Name | copper(1+);1-ethoxyethenolate |
| PubChem CID | 73187688 |
| Molecular Formula | C4H7CuO2 |
| Molecular Weight | 150.64 g/mol |
| Exact Mass | 149.97 |
| IUPAC Name | copper(1+);1-ethoxyethenolate |
| SMILES | C=C([O-])OCC.[Cu+] |
| InChI | InChI=1S/C4H8O2.Cu/c1-3-6-4(2)5;/h5H,2-3H2,1H3;/q;+1/p-1 |
| InChIKey | LLQLDQFMBIYMOQ-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.64 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);1-ethoxyethenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);1-ethoxyethenolate?
The IUPAC name of copper(1+);1-ethoxyethenolate (CID 73187688) is copper(1+);1-ethoxyethenolate.
What is the SMILES notation for copper(1+);1-ethoxyethenolate?
The canonical SMILES for copper(1+);1-ethoxyethenolate is C=C([O-])OCC.[Cu+].
What is the InChIKey of copper(1+);1-ethoxyethenolate?
The InChIKey is LLQLDQFMBIYMOQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O2.Cu/c1-3-6-4(2)5;/h5H,2-3H2,1H3;/q;+1/p-1.
What are the key properties of copper(1+);1-ethoxyethenolate?
copper(1+);1-ethoxyethenolate has a molecular weight of 150.64 g/mol, XLogP of -0.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);1-ethoxyethenolate is sourced from PubChem (CID 73187688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).