C9H18O — CID 144636668
ethane;2-ethoxy-3-methylbuta-1,3-diene (PubChem CID 144636668) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is ethane;2-ethoxy-3-methylbuta-1,3-diene.
| Compound Name | ethane;2-ethoxy-3-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 144636668 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | ethane;2-ethoxy-3-methylbuta-1,3-diene |
| SMILES | C=C(C)C(=C)OCC.CC |
| InChI | InChI=1S/C7H12O.C2H6/c1-5-8-7(4)6(2)3;1-2/h2,4-5H2,1,3H3;1-2H3 |
| InChIKey | XXVOABXCLNDEGP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|