C6H9ClO — CID 102247502
2-chloro-3-ethoxybuta-1,3-diene (PubChem CID 102247502) has the molecular formula C6H9ClO and a molecular weight of 132.59 g/mol. Its IUPAC name is 2-chloro-3-ethoxybuta-1,3-diene.
| Compound Name | 2-chloro-3-ethoxybuta-1,3-diene |
|---|---|
| PubChem CID | 102247502 |
| Molecular Formula | C6H9ClO |
| Molecular Weight | 132.59 g/mol |
| Exact Mass | 132.03 |
| IUPAC Name | 2-chloro-3-ethoxybuta-1,3-diene |
| SMILES | C=C(Cl)C(=C)OCC |
| InChI | InChI=1S/C6H9ClO/c1-4-8-6(3)5(2)7/h2-4H2,1H3 |
| InChIKey | JUQQQURHDIJSEP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|