C12H24ClNO — CID 144753474
N-[2-(3-chlorobuta-1,3-dien-2-yloxy)ethyl]-N-methylpropan-1-amine;ethane (PubChem CID 144753474) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is N-[2-(3-chlorobuta-1,3-dien-2-yloxy)ethyl]-N-methylpropan-1-amine;ethane.
| Compound Name | N-[2-(3-chlorobuta-1,3-dien-2-yloxy)ethyl]-N-methylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 144753474 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N-[2-(3-chlorobuta-1,3-dien-2-yloxy)ethyl]-N-methylpropan-1-amine;ethane |
| SMILES | C=C(Cl)C(=C)OCCN(C)CCC.CC |
| InChI | InChI=1S/C10H18ClNO.C2H6/c1-5-6-12(4)7-8-13-10(3)9(2)11;1-2/h2-3,5-8H2,1,4H3;1-2H3 |
| InChIKey | BYJNGEWSGRMIRK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|