C12H25ClO3Si2 — CID 134859488
(2-chloro-1-ethoxy-3-trimethylsilyloxybuta-1,3-dienoxy)-trimethylsilane (PubChem CID 134859488) has the molecular formula C12H25ClO3Si2 and a molecular weight of 308.95 g/mol. Its IUPAC name is (2-chloro-1-ethoxy-3-trimethylsilyloxybuta-1,3-dienoxy)-trimethylsilane.
| Compound Name | (2-chloro-1-ethoxy-3-trimethylsilyloxybuta-1,3-dienoxy)-trimethylsilane |
|---|---|
| PubChem CID | 134859488 |
| Molecular Formula | C12H25ClO3Si2 |
| Molecular Weight | 308.95 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2-chloro-1-ethoxy-3-trimethylsilyloxybuta-1,3-dienoxy)-trimethylsilane |
| SMILES | C=C(O[Si](C)(C)C)C(Cl)=C(OCC)O[Si](C)(C)C |
| InChI | InChI=1S/C12H25ClO3Si2/c1-9-14-12(16-18(6,7)8)11(13)10(2)15-17(3,4)5/h2,9H2,1,3-8H3 |
| InChIKey | XDQMERBEVSVOOO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.95 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|