About 1-ethoxyethenyl 2-chloroprop-2-enoate
1-ethoxyethenyl 2-chloroprop-2-enoate (PubChem CID 170164191) has the molecular formula C7H9ClO3
and a molecular weight of 176.60 g/mol. Its IUPAC name is 1-ethoxyethenyl 2-chloroprop-2-enoate.
Molecular Properties
| Compound Name | 1-ethoxyethenyl 2-chloroprop-2-enoate |
| PubChem CID | 170164191 |
| Molecular Formula | C7H9ClO3 |
| Molecular Weight | 176.60 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 1-ethoxyethenyl 2-chloroprop-2-enoate |
| SMILES | C=C(OCC)OC(=O)C(=C)Cl |
| InChI | InChI=1S/C7H9ClO3/c1-4-10-6(3)11-7(9)5(2)8/h2-4H2,1H3 |
| InChIKey | NBNZCGVOBLLLCA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.60 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethenyl 2-chloroprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethenyl 2-chloroprop-2-enoate?
The IUPAC name of 1-ethoxyethenyl 2-chloroprop-2-enoate (CID 170164191) is 1-ethoxyethenyl 2-chloroprop-2-enoate.
What is the SMILES notation for 1-ethoxyethenyl 2-chloroprop-2-enoate?
The canonical SMILES for 1-ethoxyethenyl 2-chloroprop-2-enoate is C=C(OCC)OC(=O)C(=C)Cl.
What is the InChIKey of 1-ethoxyethenyl 2-chloroprop-2-enoate?
The InChIKey is NBNZCGVOBLLLCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClO3/c1-4-10-6(3)11-7(9)5(2)8/h2-4H2,1H3.
What are the key properties of 1-ethoxyethenyl 2-chloroprop-2-enoate?
1-ethoxyethenyl 2-chloroprop-2-enoate has a molecular weight of 176.60 g/mol, XLogP of 1.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethenyl 2-chloroprop-2-enoate is sourced from PubChem (CID 170164191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).