About ethyl 2-chloro-2-oxoacetate;hydrate
ethyl 2-chloro-2-oxoacetate;hydrate (PubChem CID 174430956) has the molecular formula C4H7ClO4
and a molecular weight of 154.55 g/mol. Its IUPAC name is ethyl 2-chloro-2-oxoacetate;hydrate.
Molecular Properties
| Compound Name | ethyl 2-chloro-2-oxoacetate;hydrate |
| PubChem CID | 174430956 |
| Molecular Formula | C4H7ClO4 |
| Molecular Weight | 154.55 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | ethyl 2-chloro-2-oxoacetate;hydrate |
| SMILES | CCOC(=O)C(=O)Cl.O |
| InChI | InChI=1S/C4H5ClO3.H2O/c1-2-8-4(7)3(5)6;/h2H2,1H3;1H2 |
| InChIKey | NRARHQBWSCOVQC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 74.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.55 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-chloro-2-oxoacetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-chloro-2-oxoacetate;hydrate?
The IUPAC name of ethyl 2-chloro-2-oxoacetate;hydrate (CID 174430956) is ethyl 2-chloro-2-oxoacetate;hydrate.
What is the SMILES notation for ethyl 2-chloro-2-oxoacetate;hydrate?
The canonical SMILES for ethyl 2-chloro-2-oxoacetate;hydrate is CCOC(=O)C(=O)Cl.O.
What is the InChIKey of ethyl 2-chloro-2-oxoacetate;hydrate?
The InChIKey is NRARHQBWSCOVQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO3.H2O/c1-2-8-4(7)3(5)6;/h2H2,1H3;1H2.
What are the key properties of ethyl 2-chloro-2-oxoacetate;hydrate?
ethyl 2-chloro-2-oxoacetate;hydrate has a molecular weight of 154.55 g/mol, XLogP of -0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-chloro-2-oxoacetate;hydrate is sourced from PubChem (CID 174430956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).