C7H5Cl5O2 — CID 12721607
ethyl 3,4,4-trichloro-2-(dichloromethylidene)but-3-enoate (PubChem CID 12721607) has the molecular formula C7H5Cl5O2 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl 3,4,4-trichloro-2-(dichloromethylidene)but-3-enoate.
| Compound Name | ethyl 3,4,4-trichloro-2-(dichloromethylidene)but-3-enoate |
|---|---|
| PubChem CID | 12721607 |
| Molecular Formula | C7H5Cl5O2 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 295.87 |
| IUPAC Name | ethyl 3,4,4-trichloro-2-(dichloromethylidene)but-3-enoate |
| SMILES | CCOC(=O)C(=C(Cl)Cl)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C7H5Cl5O2/c1-2-14-7(13)3(5(9)10)4(8)6(11)12/h2H2,1H3 |
| InChIKey | LFKXHFLWYJMGMQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|