C24H24Cl2O6 — CID 11317579
diethyl (2Z,3Z)-2,3-bis[chloro-(4-methylphenoxy)methylidene]butanedioate (PubChem CID 11317579) has the molecular formula C24H24Cl2O6 and a molecular weight of 479.36 g/mol. Its IUPAC name is diethyl (2Z,3Z)-2,3-bis[chloro-(4-methylphenoxy)methylidene]butanedioate.
| Compound Name | diethyl (2Z,3Z)-2,3-bis[chloro-(4-methylphenoxy)methylidene]butanedioate |
|---|---|
| PubChem CID | 11317579 |
| Molecular Formula | C24H24Cl2O6 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | diethyl (2Z,3Z)-2,3-bis[chloro-(4-methylphenoxy)methylidene]butanedioate |
| SMILES | CCOC(=O)C(=C(\Cl)Oc1ccc(C)cc1)/C(C(=O)OCC)=C(/Cl)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C24H24Cl2O6/c1-5-29-23(27)19(21(25)31-17-11-7-15(3)8-12-17)20(24(28)30-6-2)22(26)32-18-13-9-16(4)10-14-18/h7-14H,5-6H2,1-4H3/b21-19+,22-20+ |
| InChIKey | JDHKBUWMWPPNJW-FLFKKZLDSA-N |
| XLogP | 5.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|