C24H23NO3 — CID 59734862
[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl] 2-oxobutanoate (PubChem CID 59734862) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is [4-(4-methyl-N-(4-methylphenyl)anilino)phenyl] 2-oxobutanoate.
| Compound Name | [4-(4-methyl-N-(4-methylphenyl)anilino)phenyl] 2-oxobutanoate |
|---|---|
| PubChem CID | 59734862 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [4-(4-methyl-N-(4-methylphenyl)anilino)phenyl] 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)Oc1ccc(N(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23NO3/c1-4-23(26)24(27)28-22-15-13-21(14-16-22)25(19-9-5-17(2)6-10-19)20-11-7-18(3)8-12-20/h5-16H,4H2,1-3H3 |
| InChIKey | QLOZYWTYTNGKAP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|