C46H40N2O5 — CID 22089867
[4-(4-methyl-N-[4-[[4-(4-methyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]methoxymethyl]phenyl]anilino)phenyl] prop-2-enoate (PubChem CID 22089867) has the molecular formula C46H40N2O5 and a molecular weight of 700.83 g/mol. Its IUPAC name is [4-(4-methyl-N-[4-[[4-(4-methyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]methoxymethyl]phenyl]anilino)phenyl] prop-2-enoate.
| Compound Name | [4-(4-methyl-N-[4-[[4-(4-methyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]methoxymethyl]phenyl]anilino)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 22089867 |
| Molecular Formula | C46H40N2O5 |
| Molecular Weight | 700.83 g/mol |
| Exact Mass | 700.29 |
| IUPAC Name | [4-(4-methyl-N-[4-[[4-(4-methyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]methoxymethyl]phenyl]anilino)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(c2ccc(C)cc2)c2ccc(COCc3ccc(N(c4ccc(C)cc4)c4ccc(OC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H40N2O5/c1-5-45(49)52-43-27-23-41(24-28-43)47(37-15-7-33(3)8-16-37)39-19-11-35(12-20-39)31-51-32-36-13-21-40(22-14-36)48(38-17-9-34(4)10-18-38)42-25-29-44(30-26-42)53-46(50)6-2/h5-30H,1-2,31-32H2,3-4H3 |
| InChIKey | KPCLLNPHUDJSFK-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.83 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|