C34H26BNO4 — CID 90291409
CID 90291409 (PubChem CID 90291409) has the molecular formula C34H26BNO4 and a molecular weight of 523.40 g/mol.
| Compound Name | CID 90291409 |
|---|---|
| PubChem CID | 90291409 |
| Molecular Formula | C34H26BNO4 |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Oc2ccc(N(c3ccc(C)cc3)c3ccc(Oc4ccc(OC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H26BNO4/c1-3-34(37)40-33-22-20-32(21-23-33)39-31-18-12-28(13-19-31)36(26-8-4-24(2)5-9-26)27-10-16-30(17-11-27)38-29-14-6-25(35)7-15-29/h3-23H,1H2,2H3 |
| InChIKey | WBGNXAGYZKPHBC-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|