C35H26BNO2 — CID 90291377
CID 90291377 (PubChem CID 90291377) has the molecular formula C35H26BNO2 and a molecular weight of 503.41 g/mol.
| Compound Name | CID 90291377 |
|---|---|
| PubChem CID | 90291377 |
| Molecular Formula | C35H26BNO2 |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2ccc(N(c3ccc(C)cc3)c3ccc(-c4ccc(OC(=O)C5=CC5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H26BNO2/c1-24-2-16-31(17-3-24)37(32-18-8-26(9-19-32)25-6-14-30(36)15-7-25)33-20-10-27(11-21-33)28-12-22-34(23-13-28)39-35(38)29-4-5-29/h2-4,6-23H,5H2,1H3 |
| InChIKey | HSKSZVUONMXGTO-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|