C8H18O4 — CID 88771000
1,1-diethoxyethene;ethane-1,2-diol (PubChem CID 88771000) has the molecular formula C8H18O4 and a molecular weight of 178.23 g/mol. Its IUPAC name is 1,1-diethoxyethene;ethane-1,2-diol.
| Compound Name | 1,1-diethoxyethene;ethane-1,2-diol |
|---|---|
| PubChem CID | 88771000 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1,1-diethoxyethene;ethane-1,2-diol |
| SMILES | C=C(OCC)OCC.OCCO |
| InChI | InChI=1S/C6H12O2.C2H6O2/c1-4-7-6(3)8-5-2;3-1-2-4/h3-5H2,1-2H3;3-4H,1-2H2 |
| InChIKey | XPLOFRHWHJQZKJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|