About tetrakis(ethane-1,2-diol);2-methylprop-1-ene
tetrakis(ethane-1,2-diol);2-methylprop-1-ene (PubChem CID 173101980) has the molecular formula C12H32O8
and a molecular weight of 304.38 g/mol. Its IUPAC name is tetrakis(ethane-1,2-diol);2-methylprop-1-ene.
Molecular Properties
| Compound Name | tetrakis(ethane-1,2-diol);2-methylprop-1-ene |
| PubChem CID | 173101980 |
| Molecular Formula | C12H32O8 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | tetrakis(ethane-1,2-diol);2-methylprop-1-ene |
| SMILES | C=C(C)C.OCCO.OCCO.OCCO.OCCO |
| InChI | InChI=1S/C4H8.4C2H6O2/c1-4(2)3;4*3-1-2-4/h1H2,2-3H3;4*3-4H,1-2H2 |
| InChIKey | UWFBJQZJISYBEE-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(ethane-1,2-diol);2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(ethane-1,2-diol);2-methylprop-1-ene?
The IUPAC name of tetrakis(ethane-1,2-diol);2-methylprop-1-ene (CID 173101980) is tetrakis(ethane-1,2-diol);2-methylprop-1-ene.
What is the SMILES notation for tetrakis(ethane-1,2-diol);2-methylprop-1-ene?
The canonical SMILES for tetrakis(ethane-1,2-diol);2-methylprop-1-ene is C=C(C)C.OCCO.OCCO.OCCO.OCCO.
What is the InChIKey of tetrakis(ethane-1,2-diol);2-methylprop-1-ene?
The InChIKey is UWFBJQZJISYBEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.4C2H6O2/c1-4(2)3;4*3-1-2-4/h1H2,2-3H3;4*3-4H,1-2H2.
What are the key properties of tetrakis(ethane-1,2-diol);2-methylprop-1-ene?
tetrakis(ethane-1,2-diol);2-methylprop-1-ene has a molecular weight of 304.38 g/mol, XLogP of -2.53, 4 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(ethane-1,2-diol);2-methylprop-1-ene is sourced from PubChem (CID 173101980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).