C5H12O3 — CID 87135468
ethane-1,2-diol;prop-1-en-2-ol (PubChem CID 87135468) has the molecular formula C5H12O3 and a molecular weight of 120.15 g/mol. Its IUPAC name is ethane-1,2-diol;prop-1-en-2-ol.
| Compound Name | ethane-1,2-diol;prop-1-en-2-ol |
|---|---|
| PubChem CID | 87135468 |
| Molecular Formula | C5H12O3 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | ethane-1,2-diol;prop-1-en-2-ol |
| SMILES | C=C(C)O.OCCO |
| InChI | InChI=1S/C3H6O.C2H6O2/c1-3(2)4;3-1-2-4/h4H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | HRUCBTTTZNQHMO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|