C6H12O5 — CID 87450882
ethane-1,2-diol;2-methylprop-2-eneperoxoic acid (PubChem CID 87450882) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is ethane-1,2-diol;2-methylprop-2-eneperoxoic acid.
| Compound Name | ethane-1,2-diol;2-methylprop-2-eneperoxoic acid |
|---|---|
| PubChem CID | 87450882 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | ethane-1,2-diol;2-methylprop-2-eneperoxoic acid |
| SMILES | C=C(C)C(=O)OO.OCCO |
| InChI | InChI=1S/C4H6O3.C2H6O2/c1-3(2)4(5)7-6;3-1-2-4/h6H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | ZMALURAZHTZHRD-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|