C13H18O10 — CID 159827497
(Z)-but-2-enedioic acid;2-hydroxyethyl prop-2-enoate;2-methylprop-2-eneperoxoic acid (PubChem CID 159827497) has the molecular formula C13H18O10 and a molecular weight of 334.28 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-hydroxyethyl prop-2-enoate;2-methylprop-2-eneperoxoic acid.
| Compound Name | (Z)-but-2-enedioic acid;2-hydroxyethyl prop-2-enoate;2-methylprop-2-eneperoxoic acid |
|---|---|
| PubChem CID | 159827497 |
| Molecular Formula | C13H18O10 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-hydroxyethyl prop-2-enoate;2-methylprop-2-eneperoxoic acid |
| SMILES | C=C(C)C(=O)OO.C=CC(=O)OCCO.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C5H8O3.C4H4O4.C4H6O3/c1-2-5(7)8-4-3-6;5-3(6)1-2-4(7)8;1-3(2)4(5)7-6/h2,6H,1,3-4H2;1-2H,(H,5,6)(H,7,8);6H,1H2,2H3/b;2-1-; |
| InChIKey | PPBMUFOYTFJVIQ-FJOGWHKWSA-N |
| XLogP | -0.00 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|