C10H14N2O7 — CID 86757520
(Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid;2-hydroxyethyl prop-2-enoate (PubChem CID 86757520) has the molecular formula C10H14N2O7 and a molecular weight of 274.23 g/mol. Its IUPAC name is (Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid;2-hydroxyethyl prop-2-enoate.
| Compound Name | (Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid;2-hydroxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 86757520 |
| Molecular Formula | C10H14N2O7 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid;2-hydroxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO.NC(=O)NC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C5H6N2O4.C5H8O3/c6-5(11)7-3(8)1-2-4(9)10;1-2-5(7)8-4-3-6/h1-2H,(H,9,10)(H3,6,7,8,11);2,6H,1,3-4H2/b2-1-; |
| InChIKey | MOBHUMFHJAAIRR-ODZAUARKSA-N |
| XLogP | -1.47 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|