C12H22O7 — CID 159522271
2-hydroxyethyl prop-2-enoate;2-methylprop-2-enoic acid;propane-1,2-diol (PubChem CID 159522271) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-hydroxyethyl prop-2-enoate;2-methylprop-2-enoic acid;propane-1,2-diol.
| Compound Name | 2-hydroxyethyl prop-2-enoate;2-methylprop-2-enoic acid;propane-1,2-diol |
|---|---|
| PubChem CID | 159522271 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate;2-methylprop-2-enoic acid;propane-1,2-diol |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OCCO.CC(O)CO |
| InChI | InChI=1S/C5H8O3.C4H6O2.C3H8O2/c1-2-5(7)8-4-3-6;1-3(2)4(5)6;1-3(5)2-4/h2,6H,1,3-4H2;1H2,2H3,(H,5,6);3-5H,2H2,1H3 |
| InChIKey | MBYKMRSOGPXFDO-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|