C10H14F2O2 — CID 145009677
(3Z)-2,5-diethoxy-3,4-difluorohexa-1,3,5-triene (PubChem CID 145009677) has the molecular formula C10H14F2O2 and a molecular weight of 204.22 g/mol. Its IUPAC name is (3Z)-2,5-diethoxy-3,4-difluorohexa-1,3,5-triene.
| Compound Name | (3Z)-2,5-diethoxy-3,4-difluorohexa-1,3,5-triene |
|---|---|
| PubChem CID | 145009677 |
| Molecular Formula | C10H14F2O2 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (3Z)-2,5-diethoxy-3,4-difluorohexa-1,3,5-triene |
| SMILES | C=C(OCC)/C(F)=C(/F)C(=C)OCC |
| InChI | InChI=1S/C10H14F2O2/c1-5-13-7(3)9(11)10(12)8(4)14-6-2/h3-6H2,1-2H3/b10-9- |
| InChIKey | IBOSMDMSEPEIJS-KTKRTIGZSA-N |
| XLogP | 3.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|