C28H24F4O3 — CID 143909647
1-[4-[(3Z)-5-ethoxy-3,4-difluoro-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene (PubChem CID 143909647) has the molecular formula C28H24F4O3 and a molecular weight of 484.49 g/mol. Its IUPAC name is 1-[4-[(3Z)-5-ethoxy-3,4-difluoro-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene.
| Compound Name | 1-[4-[(3Z)-5-ethoxy-3,4-difluoro-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 143909647 |
| Molecular Formula | C28H24F4O3 |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-[4-[(3Z)-5-ethoxy-3,4-difluoro-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene |
| SMILES | C=C(COc1ccc(-c2ccc(-c3ccc(OC)cc3)c(F)c2F)cc1)/C(F)=C(/F)C(=C)OCC |
| InChI | InChI=1S/C28H24F4O3/c1-5-34-18(3)26(30)25(29)17(2)16-35-22-12-8-20(9-13-22)24-15-14-23(27(31)28(24)32)19-6-10-21(33-4)11-7-19/h6-15H,2-3,5,16H2,1,4H3/b26-25- |
| InChIKey | GAJPRBFKXHWZSE-QPLCGJKRSA-N |
| XLogP | 7.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|