C27H28F4O2 — CID 143909651
1-[4-[(3Z)-3,4-difluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluoro-4-(4-methylcyclohexyl)benzene (PubChem CID 143909651) has the molecular formula C27H28F4O2 and a molecular weight of 460.51 g/mol. Its IUPAC name is 1-[4-[(3Z)-3,4-difluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluoro-4-(4-methylcyclohexyl)benzene.
| Compound Name | 1-[4-[(3Z)-3,4-difluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluoro-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 143909651 |
| Molecular Formula | C27H28F4O2 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-[4-[(3Z)-3,4-difluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluoro-4-(4-methylcyclohexyl)benzene |
| SMILES | C=C(COc1ccc(-c2ccc(C3CCC(C)CC3)c(F)c2F)cc1)/C(F)=C(/F)C(=C)OC |
| InChI | InChI=1S/C27H28F4O2/c1-16-5-7-19(8-6-16)22-13-14-23(27(31)26(22)30)20-9-11-21(12-10-20)33-15-17(2)24(28)25(29)18(3)32-4/h9-14,16,19H,2-3,5-8,15H2,1,4H3/b25-24- |
| InChIKey | KVPAHJLPNINEGO-IZHYLOQSSA-N |
| XLogP | 8.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|