C30H34F4O3 — CID 143909075
but-1-ene;4-[4-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluorophenyl]cyclohexan-1-ol (PubChem CID 143909075) has the molecular formula C30H34F4O3 and a molecular weight of 518.59 g/mol. Its IUPAC name is but-1-ene;4-[4-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluorophenyl]cyclohexan-1-ol.
| Compound Name | but-1-ene;4-[4-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluorophenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143909075 |
| Molecular Formula | C30H34F4O3 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | but-1-ene;4-[4-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]phenyl]-2,3-difluorophenyl]cyclohexan-1-ol |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)OCc1ccc(-c2ccc(C3CCC(O)CC3)c(F)c2F)cc1.C=CCC |
| InChI | InChI=1S/C26H26F4O3.C4H8/c1-15(32-3)23(27)24(28)16(2)33-14-17-4-6-18(7-5-17)21-12-13-22(26(30)25(21)29)19-8-10-20(31)11-9-19;1-3-4-2/h4-7,12-13,19-20,31H,1-2,8-11,14H2,3H3;3H,1,4H2,2H3/b24-23-; |
| InChIKey | NJSNQGWNBFJCND-DCXSSQDFSA-N |
| XLogP | 8.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|