C26H27F3O3 — CID 143909336
4-[2,3-difluoro-4-[4-[(3E)-3-fluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]cyclohexyl]phenyl]phenol (PubChem CID 143909336) has the molecular formula C26H27F3O3 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-[2,3-difluoro-4-[4-[(3E)-3-fluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]cyclohexyl]phenyl]phenol.
| Compound Name | 4-[2,3-difluoro-4-[4-[(3E)-3-fluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]cyclohexyl]phenyl]phenol |
|---|---|
| PubChem CID | 143909336 |
| Molecular Formula | C26H27F3O3 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 4-[2,3-difluoro-4-[4-[(3E)-3-fluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]cyclohexyl]phenyl]phenol |
| SMILES | C=C(/C=C(/F)C(=C)COC1CCC(c2ccc(-c3ccc(O)cc3)c(F)c2F)CC1)OC |
| InChI | InChI=1S/C26H27F3O3/c1-16(24(27)14-17(2)31-3)15-32-21-10-6-19(7-11-21)23-13-12-22(25(28)26(23)29)18-4-8-20(30)9-5-18/h4-5,8-9,12-14,19,21,30H,1-2,6-7,10-11,15H2,3H3/b24-14+ |
| InChIKey | GSBMCRDCWVYRGQ-ZVHZXABRSA-N |
| XLogP | 6.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|