C27H27F3O4 — CID 143909022
[(3E)-5-ethoxy-4-fluorohexa-1,3,5-trien-2-yl] 4-[2,3-difluoro-4-(4-hydroxyphenyl)phenyl]cyclohexane-1-carboxylate (PubChem CID 143909022) has the molecular formula C27H27F3O4 and a molecular weight of 472.50 g/mol. Its IUPAC name is [(3E)-5-ethoxy-4-fluorohexa-1,3,5-trien-2-yl] 4-[2,3-difluoro-4-(4-hydroxyphenyl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | [(3E)-5-ethoxy-4-fluorohexa-1,3,5-trien-2-yl] 4-[2,3-difluoro-4-(4-hydroxyphenyl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 143909022 |
| Molecular Formula | C27H27F3O4 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | [(3E)-5-ethoxy-4-fluorohexa-1,3,5-trien-2-yl] 4-[2,3-difluoro-4-(4-hydroxyphenyl)phenyl]cyclohexane-1-carboxylate |
| SMILES | C=C(/C=C(/F)C(=C)OCC)OC(=O)C1CCC(c2ccc(-c3ccc(O)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C27H27F3O4/c1-4-33-17(3)24(28)15-16(2)34-27(32)20-7-5-18(6-8-20)22-13-14-23(26(30)25(22)29)19-9-11-21(31)12-10-19/h9-15,18,20,31H,2-8H2,1H3/b24-15+ |
| InChIKey | LZXQTUGYQOOJDZ-BUVRLJJBSA-N |
| XLogP | 7.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|