C29H32F4O3 — CID 143909194
1-[4-[[(3Z)-5-ethoxy-3,4-difluorohexa-1,3,5-trien-2-yl]oxymethyl]cyclohexyl]-4-(4-ethoxyphenyl)-2,3-difluorobenzene (PubChem CID 143909194) has the molecular formula C29H32F4O3 and a molecular weight of 504.56 g/mol. Its IUPAC name is 1-[4-[[(3Z)-5-ethoxy-3,4-difluorohexa-1,3,5-trien-2-yl]oxymethyl]cyclohexyl]-4-(4-ethoxyphenyl)-2,3-difluorobenzene.
| Compound Name | 1-[4-[[(3Z)-5-ethoxy-3,4-difluorohexa-1,3,5-trien-2-yl]oxymethyl]cyclohexyl]-4-(4-ethoxyphenyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 143909194 |
| Molecular Formula | C29H32F4O3 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 1-[4-[[(3Z)-5-ethoxy-3,4-difluorohexa-1,3,5-trien-2-yl]oxymethyl]cyclohexyl]-4-(4-ethoxyphenyl)-2,3-difluorobenzene |
| SMILES | C=C(OCC)/C(F)=C(/F)C(=C)OCC1CCC(c2ccc(-c3ccc(OCC)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H32F4O3/c1-5-34-18(3)26(30)27(31)19(4)36-17-20-7-9-21(10-8-20)24-15-16-25(29(33)28(24)32)22-11-13-23(14-12-22)35-6-2/h11-16,20-21H,3-10,17H2,1-2H3/b27-26- |
| InChIKey | SGLIAEYIQCQQHM-RQZHXJHFSA-N |
| XLogP | 8.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|