C30H40F4O3 — CID 143908847
1-(4-butoxycyclohexyl)-4-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]cyclohexyl]-2,3-difluorobenzene (PubChem CID 143908847) has the molecular formula C30H40F4O3 and a molecular weight of 524.64 g/mol. Its IUPAC name is 1-(4-butoxycyclohexyl)-4-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]cyclohexyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-butoxycyclohexyl)-4-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]cyclohexyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 143908847 |
| Molecular Formula | C30H40F4O3 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 1-(4-butoxycyclohexyl)-4-[4-[[(3Z)-3,4-difluoro-5-methoxyhexa-1,3,5-trien-2-yl]oxymethyl]cyclohexyl]-2,3-difluorobenzene |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)OCC1CCC(c2ccc(C3CCC(OCCCC)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C30H40F4O3/c1-5-6-17-36-24-13-11-23(12-14-24)26-16-15-25(29(33)30(26)34)22-9-7-21(8-10-22)18-37-20(3)28(32)27(31)19(2)35-4/h15-16,21-24H,2-3,5-14,17-18H2,1,4H3/b28-27- |
| InChIKey | QCVGUZLLYKPRPZ-DQSJHHFOSA-N |
| XLogP | 8.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|