C16H24F2O2 — CID 143286437
1-[[(3Z)-5-ethoxy-3,4-difluorohexa-1,3,5-trien-2-yl]oxymethyl]-4-methylcyclohexane (PubChem CID 143286437) has the molecular formula C16H24F2O2 and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-[[(3Z)-5-ethoxy-3,4-difluorohexa-1,3,5-trien-2-yl]oxymethyl]-4-methylcyclohexane.
| Compound Name | 1-[[(3Z)-5-ethoxy-3,4-difluorohexa-1,3,5-trien-2-yl]oxymethyl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 143286437 |
| Molecular Formula | C16H24F2O2 |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[[(3Z)-5-ethoxy-3,4-difluorohexa-1,3,5-trien-2-yl]oxymethyl]-4-methylcyclohexane |
| SMILES | C=C(OCC)/C(F)=C(/F)C(=C)OCC1CCC(C)CC1 |
| InChI | InChI=1S/C16H24F2O2/c1-5-19-12(3)15(17)16(18)13(4)20-10-14-8-6-11(2)7-9-14/h11,14H,3-10H2,1-2H3/b16-15- |
| InChIKey | RAKNCUQNJBNVMN-NXVVXOECSA-N |
| XLogP | 5.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|