C20H24F4O2 — CID 145301366
2-methyl-5-[[(3Z,7Z)-3,4,7,8-tetrafluoro-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]oxymethyl]oxane (PubChem CID 145301366) has the molecular formula C20H24F4O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is 2-methyl-5-[[(3Z,7Z)-3,4,7,8-tetrafluoro-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]oxymethyl]oxane.
| Compound Name | 2-methyl-5-[[(3Z,7Z)-3,4,7,8-tetrafluoro-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]oxymethyl]oxane |
|---|---|
| PubChem CID | 145301366 |
| Molecular Formula | C20H24F4O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-methyl-5-[[(3Z,7Z)-3,4,7,8-tetrafluoro-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]oxymethyl]oxane |
| SMILES | C=C(C)/C(F)=C(/F)C(=C)C(=C)/C(F)=C(\F)C(=C)OCC1CCC(C)OC1 |
| InChI | InChI=1S/C20H24F4O2/c1-11(2)17(21)18(22)13(4)14(5)19(23)20(24)15(6)26-10-16-8-7-12(3)25-9-16/h12,16H,1,4-10H2,2-3H3/b18-17-,20-19- |
| InChIKey | MTMHDOPJTIYFDN-RXGVRZIVSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|