C13H18F2O2 — CID 126727548
(3Z)-5-(cyclohexylmethoxy)-3,4-difluorohexa-1,3,5-trien-2-ol (PubChem CID 126727548) has the molecular formula C13H18F2O2 and a molecular weight of 244.28 g/mol. Its IUPAC name is (3Z)-5-(cyclohexylmethoxy)-3,4-difluorohexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-5-(cyclohexylmethoxy)-3,4-difluorohexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 126727548 |
| Molecular Formula | C13H18F2O2 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (3Z)-5-(cyclohexylmethoxy)-3,4-difluorohexa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C(F)=C(/F)C(=C)OCC1CCCCC1 |
| InChI | InChI=1S/C13H18F2O2/c1-9(16)12(14)13(15)10(2)17-8-11-6-4-3-5-7-11/h11,16H,1-8H2/b13-12- |
| InChIKey | KOCUZNRIJSGYHP-SEYXRHQNSA-N |
| XLogP | 4.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|