About cyclohexylmethoxymethylcyclohexane;hydroxylamine
cyclohexylmethoxymethylcyclohexane;hydroxylamine (PubChem CID 67759423) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is cyclohexylmethoxymethylcyclohexane;hydroxylamine.
Molecular Properties
| Compound Name | cyclohexylmethoxymethylcyclohexane;hydroxylamine |
| PubChem CID | 67759423 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | cyclohexylmethoxymethylcyclohexane;hydroxylamine |
| SMILES | C1CCC(COCC2CCCCC2)CC1.NO |
| InChI | InChI=1S/C14H26O.H3NO/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-2/h13-14H,1-12H2;2H,1H2 |
| InChIKey | YZIYPJYRIOSHKN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylmethoxymethylcyclohexane;hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethoxymethylcyclohexane;hydroxylamine?
The IUPAC name of cyclohexylmethoxymethylcyclohexane;hydroxylamine (CID 67759423) is cyclohexylmethoxymethylcyclohexane;hydroxylamine.
What is the SMILES notation for cyclohexylmethoxymethylcyclohexane;hydroxylamine?
The canonical SMILES for cyclohexylmethoxymethylcyclohexane;hydroxylamine is C1CCC(COCC2CCCCC2)CC1.NO.
What is the InChIKey of cyclohexylmethoxymethylcyclohexane;hydroxylamine?
The InChIKey is YZIYPJYRIOSHKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O.H3NO/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-2/h13-14H,1-12H2;2H,1H2.
What are the key properties of cyclohexylmethoxymethylcyclohexane;hydroxylamine?
cyclohexylmethoxymethylcyclohexane;hydroxylamine has a molecular weight of 243.39 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethoxymethylcyclohexane;hydroxylamine is sourced from PubChem (CID 67759423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).