About 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide
2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide (PubChem CID 77124799) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide |
| PubChem CID | 77124799 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide |
| SMILES | NC(COCC1CCCC1)=NO |
| InChI | InChI=1S/C8H16N2O2/c9-8(10-11)6-12-5-7-3-1-2-4-7/h7,11H,1-6H2,(H2,9,10) |
| InChIKey | XMSVUDDUYKIVTO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide?
The IUPAC name of 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide (CID 77124799) is 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide?
The canonical SMILES for 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide is NC(COCC1CCCC1)=NO.
What is the InChIKey of 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide?
The InChIKey is XMSVUDDUYKIVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c9-8(10-11)6-12-5-7-3-1-2-4-7/h7,11H,1-6H2,(H2,9,10).
What are the key properties of 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide?
2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide has a molecular weight of 172.23 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylmethoxy)-N'-hydroxyethanimidamide is sourced from PubChem (CID 77124799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).