About 2-ethoxy-N'-hydroxyethanimidamide
2-ethoxy-N'-hydroxyethanimidamide (PubChem CID 10582776) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 2-ethoxy-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-ethoxy-N'-hydroxyethanimidamide |
| PubChem CID | 10582776 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | 2-ethoxy-N'-hydroxyethanimidamide |
| SMILES | CCOC/C(N)=N/O |
| InChI | InChI=1S/C4H10N2O2/c1-2-8-3-4(5)6-7/h7H,2-3H2,1H3,(H2,5,6) |
| InChIKey | FLQGZPLLJYNPHU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N'-hydroxyethanimidamide?
The IUPAC name of 2-ethoxy-N'-hydroxyethanimidamide (CID 10582776) is 2-ethoxy-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-ethoxy-N'-hydroxyethanimidamide?
The canonical SMILES for 2-ethoxy-N'-hydroxyethanimidamide is CCOC/C(N)=N/O.
What is the InChIKey of 2-ethoxy-N'-hydroxyethanimidamide?
The InChIKey is FLQGZPLLJYNPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c1-2-8-3-4(5)6-7/h7H,2-3H2,1H3,(H2,5,6).
What are the key properties of 2-ethoxy-N'-hydroxyethanimidamide?
2-ethoxy-N'-hydroxyethanimidamide has a molecular weight of 118.14 g/mol, XLogP of -0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N'-hydroxyethanimidamide is sourced from PubChem (CID 10582776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).