C7H17N3O2 — CID 77032312
2-(1-ethoxypropan-2-ylamino)-N'-hydroxyethanimidamide (PubChem CID 77032312) has the molecular formula C7H17N3O2 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-(1-ethoxypropan-2-ylamino)-N'-hydroxyethanimidamide.
| Compound Name | 2-(1-ethoxypropan-2-ylamino)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77032312 |
| Molecular Formula | C7H17N3O2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.13 |
| IUPAC Name | 2-(1-ethoxypropan-2-ylamino)-N'-hydroxyethanimidamide |
| SMILES | CCOCC(C)NCC(N)=NO |
| InChI | InChI=1S/C7H17N3O2/c1-3-12-5-6(2)9-4-7(8)10-11/h6,9,11H,3-5H2,1-2H3,(H2,8,10) |
| InChIKey | ZJBIQDAWMFETDD-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|