About 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide
3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide (PubChem CID 76921489) has the molecular formula C10H21N3O3
and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide |
| PubChem CID | 76921489 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide |
| SMILES | CCOCC(C)NC(=O)C(C)(C)C(N)=NO |
| InChI | InChI=1S/C10H21N3O3/c1-5-16-6-7(2)12-9(14)10(3,4)8(11)13-15/h7,15H,5-6H2,1-4H3,(H2,11,13)(H,12,14) |
| InChIKey | FHPWVQXKERQQFM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide?
The IUPAC name of 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide (CID 76921489) is 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide.
What is the SMILES notation for 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide?
The canonical SMILES for 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide is CCOCC(C)NC(=O)C(C)(C)C(N)=NO.
What is the InChIKey of 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide?
The InChIKey is FHPWVQXKERQQFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O3/c1-5-16-6-7(2)12-9(14)10(3,4)8(11)13-15/h7,15H,5-6H2,1-4H3,(H2,11,13)(H,12,14).
What are the key properties of 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide?
3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide has a molecular weight of 231.30 g/mol, XLogP of 0.30, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(1-ethoxypropan-2-yl)-3-hydroxyimino-2,2-dimethylpropanamide is sourced from PubChem (CID 76921489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).