C8H18N2O2 — CID 78977149
(2R)-2-amino-N-(1-ethoxypropan-2-yl)propanamide (PubChem CID 78977149) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is (2R)-2-amino-N-(1-ethoxypropan-2-yl)propanamide.
| Compound Name | (2R)-2-amino-N-(1-ethoxypropan-2-yl)propanamide |
|---|---|
| PubChem CID | 78977149 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (2R)-2-amino-N-(1-ethoxypropan-2-yl)propanamide |
| SMILES | CCOCC(C)NC(=O)[C@@H](C)N |
| InChI | InChI=1S/C8H18N2O2/c1-4-12-5-6(2)10-8(11)7(3)9/h6-7H,4-5,9H2,1-3H3,(H,10,11)/t6?,7-/m1/s1 |
| InChIKey | NFXKPRLJIZWBKY-COBSHVIPSA-N |
| XLogP | -0.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |