About ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol
ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol (PubChem CID 156707108) has the molecular formula C10H25NO3
and a molecular weight of 207.31 g/mol. Its IUPAC name is ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol.
Molecular Properties
| Compound Name | ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol |
| PubChem CID | 156707108 |
| Molecular Formula | C10H25NO3 |
| Molecular Weight | 207.31 g/mol |
| Exact Mass | 207.18 |
| IUPAC Name | ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol |
| SMILES | CC.CCOCC(C)NC(C)=O.CO |
| InChI | InChI=1S/C7H15NO2.C2H6.CH4O/c1-4-10-5-6(2)8-7(3)9;2*1-2/h6H,4-5H2,1-3H3,(H,8,9);1-2H3;2H,1H3 |
| InChIKey | LCGZXRLQPNBGMC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol?
The IUPAC name of ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol (CID 156707108) is ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol.
What is the SMILES notation for ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol?
The canonical SMILES for ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol is CC.CCOCC(C)NC(C)=O.CO.
What is the InChIKey of ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol?
The InChIKey is LCGZXRLQPNBGMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C2H6.CH4O/c1-4-10-5-6(2)8-7(3)9;2*1-2/h6H,4-5H2,1-3H3,(H,8,9);1-2H3;2H,1H3.
What are the key properties of ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol?
ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol has a molecular weight of 207.31 g/mol, XLogP of 1.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(1-ethoxypropan-2-yl)acetamide;methanol is sourced from PubChem (CID 156707108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).