C12H16INO2 — CID 47903616
N-(1-ethoxypropan-2-yl)-4-iodobenzamide (PubChem CID 47903616) has the molecular formula C12H16INO2 and a molecular weight of 333.17 g/mol. Its IUPAC name is N-(1-ethoxypropan-2-yl)-4-iodobenzamide.
| Compound Name | N-(1-ethoxypropan-2-yl)-4-iodobenzamide |
|---|---|
| PubChem CID | 47903616 |
| Molecular Formula | C12H16INO2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | N-(1-ethoxypropan-2-yl)-4-iodobenzamide |
| SMILES | CCOCC(C)NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C12H16INO2/c1-3-16-8-9(2)14-12(15)10-4-6-11(13)7-5-10/h4-7,9H,3,8H2,1-2H3,(H,14,15) |
| InChIKey | LSHWIVQGJPIGRF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|