C15H21NO4 — CID 103429008
2-(1-ethoxypropan-2-ylcarbamoyl)-3,6-dimethylbenzoic acid (PubChem CID 103429008) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(1-ethoxypropan-2-ylcarbamoyl)-3,6-dimethylbenzoic acid.
| Compound Name | 2-(1-ethoxypropan-2-ylcarbamoyl)-3,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 103429008 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(1-ethoxypropan-2-ylcarbamoyl)-3,6-dimethylbenzoic acid |
| SMILES | CCOCC(C)NC(=O)c1c(C)ccc(C)c1C(=O)O |
| InChI | InChI=1S/C15H21NO4/c1-5-20-8-11(4)16-14(17)12-9(2)6-7-10(3)13(12)15(18)19/h6-7,11H,5,8H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | FJKBRAYQWCZVQZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |