About N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide
N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide (PubChem CID 114292493) has the molecular formula C10H21N3O2
and a molecular weight of 215.30 g/mol. Its IUPAC name is N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide.
Molecular Properties
| Compound Name | N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide |
| PubChem CID | 114292493 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide |
| SMILES | CCC(C)NC(=O)C(C)(CC)C(N)=NO |
| InChI | InChI=1S/C10H21N3O2/c1-5-7(3)12-9(14)10(4,6-2)8(11)13-15/h7,15H,5-6H2,1-4H3,(H2,11,13)(H,12,14) |
| InChIKey | VYJRACREUBEWOT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide?
The IUPAC name of N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide (CID 114292493) is N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide.
What is the SMILES notation for N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide?
The canonical SMILES for N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide is CCC(C)NC(=O)C(C)(CC)C(N)=NO.
What is the InChIKey of N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide?
The InChIKey is VYJRACREUBEWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2/c1-5-7(3)12-9(14)10(4,6-2)8(11)13-15/h7,15H,5-6H2,1-4H3,(H2,11,13)(H,12,14).
What are the key properties of N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide?
N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide has a molecular weight of 215.30 g/mol, XLogP of 1.06, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide is sourced from PubChem (CID 114292493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).