C14H29N3O2 — CID 114292771
2-(N'-hydroxycarbamimidoyl)-2-methyl-N-octan-2-ylbutanamide (PubChem CID 114292771) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-2-methyl-N-octan-2-ylbutanamide.
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-2-methyl-N-octan-2-ylbutanamide |
|---|---|
| PubChem CID | 114292771 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-2-methyl-N-octan-2-ylbutanamide |
| SMILES | CCCCCCC(C)NC(=O)C(C)(CC)C(N)=NO |
| InChI | InChI=1S/C14H29N3O2/c1-5-7-8-9-10-11(3)16-13(18)14(4,6-2)12(15)17-19/h11,19H,5-10H2,1-4H3,(H2,15,17)(H,16,18) |
| InChIKey | NLNJXURHEHDMNN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|