C21H32F10N2O2 — CID 3633560
2,2,3,3,4,4,5,5,6,6-decafluoro-N,N'-di(heptan-2-yl)heptanediamide (PubChem CID 3633560) has the molecular formula C21H32F10N2O2 and a molecular weight of 534.48 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-N,N'-di(heptan-2-yl)heptanediamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-N,N'-di(heptan-2-yl)heptanediamide |
|---|---|
| PubChem CID | 3633560 |
| Molecular Formula | C21H32F10N2O2 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-N,N'-di(heptan-2-yl)heptanediamide |
| SMILES | CCCCCC(C)NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NC(C)CCCCC |
| InChI | InChI=1S/C21H32F10N2O2/c1-5-7-9-11-13(3)32-15(34)17(22,23)19(26,27)21(30,31)20(28,29)18(24,25)16(35)33-14(4)12-10-8-6-2/h13-14H,5-12H2,1-4H3,(H,32,34)(H,33,35) |
| InChIKey | JDJSGEMCVHFXIK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|