C12H16F8N2O2 — CID 3089678
2,2,3,3,4,4,5,5-octafluoro-N,N'-di(propan-2-yl)hexanediamide (PubChem CID 3089678) has the molecular formula C12H16F8N2O2 and a molecular weight of 372.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N,N'-di(propan-2-yl)hexanediamide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-di(propan-2-yl)hexanediamide |
|---|---|
| PubChem CID | 3089678 |
| Molecular Formula | C12H16F8N2O2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-di(propan-2-yl)hexanediamide |
| SMILES | CC(C)NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NC(C)C |
| InChI | InChI=1S/C12H16F8N2O2/c1-5(2)21-7(23)9(13,14)11(17,18)12(19,20)10(15,16)8(24)22-6(3)4/h5-6H,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | SNJSKRIPMHTUTM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|