C15H14F15NO3 — CID 91745349
2-methylpropyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)propanoate (PubChem CID 91745349) has the molecular formula C15H14F15NO3 and a molecular weight of 541.25 g/mol. Its IUPAC name is 2-methylpropyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)propanoate.
| Compound Name | 2-methylpropyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)propanoate |
|---|---|
| PubChem CID | 91745349 |
| Molecular Formula | C15H14F15NO3 |
| Molecular Weight | 541.25 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | 2-methylpropyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)propanoate |
| SMILES | CC(C)COC(=O)C(C)NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F15NO3/c1-5(2)4-34-7(32)6(3)31-8(33)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30/h5-6H,4H2,1-3H3,(H,31,33) |
| InChIKey | ANQFQRSFUQHEFM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.25 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|