C13H12F10N2O6 — CID 3926618
2-[[7-(1-carboxyethylamino)-2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxoheptanoyl]amino]propanoic acid (PubChem CID 3926618) has the molecular formula C13H12F10N2O6 and a molecular weight of 482.23 g/mol. Its IUPAC name is 2-[[7-(1-carboxyethylamino)-2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxoheptanoyl]amino]propanoic acid.
| Compound Name | 2-[[7-(1-carboxyethylamino)-2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxoheptanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 3926618 |
| Molecular Formula | C13H12F10N2O6 |
| Molecular Weight | 482.23 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 2-[[7-(1-carboxyethylamino)-2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxoheptanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NC(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H12F10N2O6/c1-3(5(26)27)24-7(30)9(14,15)11(18,19)13(22,23)12(20,21)10(16,17)8(31)25-4(2)6(28)29/h3-4H,1-2H3,(H,24,30)(H,25,31)(H,26,27)(H,28,29) |
| InChIKey | GBZFTERUJLZSFJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|