C12H20F4N2O4 — CID 98331890
2,2,3,3-tetrafluoro-N-[(2S,3S)-3-hydroxybutan-2-yl]-N'-[(2R,3S)-3-hydroxybutan-2-yl]butanediamide (PubChem CID 98331890) has the molecular formula C12H20F4N2O4 and a molecular weight of 332.29 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(2S,3S)-3-hydroxybutan-2-yl]-N'-[(2R,3S)-3-hydroxybutan-2-yl]butanediamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(2S,3S)-3-hydroxybutan-2-yl]-N'-[(2R,3S)-3-hydroxybutan-2-yl]butanediamide |
|---|---|
| PubChem CID | 98331890 |
| Molecular Formula | C12H20F4N2O4 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(2S,3S)-3-hydroxybutan-2-yl]-N'-[(2R,3S)-3-hydroxybutan-2-yl]butanediamide |
| SMILES | C[C@H](O)[C@H](C)NC(=O)C(F)(F)C(F)(F)C(=O)N[C@H](C)[C@H](C)O |
| InChI | InChI=1S/C12H20F4N2O4/c1-5(7(3)19)17-9(21)11(13,14)12(15,16)10(22)18-6(2)8(4)20/h5-8,19-20H,1-4H3,(H,17,21)(H,18,22)/t5-,6+,7-,8-/m0/s1 |
| InChIKey | XMMDZZIYJNQNKL-YWIQKCBGSA-N |
| XLogP | 0.03 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|