C7H13Cl2NO2 — CID 130666285
2,2-dichloro-N-(3-hydroxybutan-2-yl)propanamide (PubChem CID 130666285) has the molecular formula C7H13Cl2NO2 and a molecular weight of 214.09 g/mol. Its IUPAC name is 2,2-dichloro-N-(3-hydroxybutan-2-yl)propanamide.
| Compound Name | 2,2-dichloro-N-(3-hydroxybutan-2-yl)propanamide |
|---|---|
| PubChem CID | 130666285 |
| Molecular Formula | C7H13Cl2NO2 |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 2,2-dichloro-N-(3-hydroxybutan-2-yl)propanamide |
| SMILES | CC(O)C(C)NC(=O)C(C)(Cl)Cl |
| InChI | InChI=1S/C7H13Cl2NO2/c1-4(5(2)11)10-6(12)7(3,8)9/h4-5,11H,1-3H3,(H,10,12) |
| InChIKey | CFMCYVGUTNBSGP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|